For research use only, not for therapeutic use.
2-(4-bromophenethoxy)tetrahydro-2H-pyran(CAT: L000005) finds important applications in both organic and material chemistry. In organic chemistry, it acts as a valuable building block for the synthesis of diverse organic compounds. Its structure allows for the creation of specialized molecules with unique properties. In material chemistry, this compound plays a significant role in the development of polymers and materials with tailored characteristics, making it essential for the design of specific materials for various applications.
| Catalog Number | L000005 |
| CAS Number | 79849-46-0 |
| Molecular Formula | C13H17BrO2 |
| Purity | ≥95% |
| IUPAC Name | 2-[2-(4-bromophenyl)ethoxy]oxane |
| InChI | InChI=1S/C13H17BrO2/c14-12-6-4-11(5-7-12)8-10-16-13-3-1-2-9-15-13/h4-7,13H,1-3,8-10H2 |
| InChIKey | HGKHQEVNPHCQCH-UHFFFAOYSA-N |
