For research use only. Not for therapeutic Use.
2-(4-Bromophenyl)-2-methyl propanal (Cat No.:L007522), is a chemical compound characterized by a propanal backbone with a 4-bromophenyl substituent and a methyl group attached to the second carbon atom. This compound is significant in organic synthesis and medicinal chemistry. Its unique structure suggests potential biological activities, making it valuable for further exploration in drug discovery research. Researchers study its reactivity and interactions with biological targets, aiming to design novel drugs.
Catalog Number | L007522 |
CAS Number | 32454-16-3 |
Molecular Formula | C10H11BrO |
Purity | ≥95% |
IUPAC Name | 2-(4-bromophenyl)-2-methylpropanal |
InChI | InChI=1S/C10H11BrO/c1-10(2,7-12)8-3-5-9(11)6-4-8/h3-7H,1-2H3 |
InChIKey | WDCNOQSTJRGLOG-UHFFFAOYSA-N |
SMILES | CC(C)(C=O)C1=CC=C(C=C1)Br |