For research use only. Not for therapeutic Use.
2-(4-Bromophenyl)-5-methyl-1,3,4-oxadiazole(CAT: L030980) is a heterocyclic compound featuring an oxadiazole ring with a 4-bromophenyl group attached at the 2-position and a methyl group at the 5-position. This compound is widely utilized in medicinal chemistry and materials science due to the unique properties of the oxadiazole ring system, which is known for its stability, electron-rich nature, and potential bioactivity. The bromine atom on the phenyl ring makes this compound suitable for further functionalization via cross-coupling reactions, such as Suzuki or Heck reactions. Its structure is of interest in drug development, where oxadiazole derivatives have shown potential as antimicrobial, anticancer, and anti-inflammatory agents. Additionally, the compound may also find use in the development of organic electronic materials and fluorescent probes.
CAS Number | 41421-03-8 |
Molecular Formula | C9H7BrN2O |
Purity | ≥95% |
IUPAC Name | 2-(4-bromophenyl)-5-methyl-1,3,4-oxadiazole |
InChI | InChI=1S/C9H7BrN2O/c1-6-11-12-9(13-6)7-2-4-8(10)5-3-7/h2-5H,1H3 |
InChIKey | PQSCYRJMPVYVKU-UHFFFAOYSA-N |