For research use only. Not for therapeutic Use.
2-(4-Bromophenyl)-5-phenylthiophene(Cat No.:M137591)is an aromatic compound featuring a brominated phenyl group and a phenyl group attached to a thiophene ring. This compound is particularly useful in organic synthesis, especially in the development of pharmaceuticals, agrochemicals, and advanced materials. The bromine atom provides a reactive site for further functionalization, making it a versatile intermediate for constructing complex molecular architectures. Its conjugated system, combining thiophene and phenyl rings, also makes it valuable in the study of electronic materials, such as organic semiconductors and light-emitting devices.
CAS Number | 118621-30-0 |
Synonyms | 2-(4-Bromophenyl)-5-phenylthiophene |
Molecular Formula | C16H11BrS |
Purity | ≥95% |
IUPAC Name | 2-(4-bromophenyl)-5-phenylthiophene |
InChI | InChI=1S/C16H11BrS/c17-14-8-6-13(7-9-14)16-11-10-15(18-16)12-4-2-1-3-5-12/h1-11H |
InChIKey | YMDCOEOZWHXGTM-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=CC=C(S2)C3=CC=C(C=C3)Br |