For research use only. Not for therapeutic Use.
2-(4-Bromophenyl)propanenitrile(CAT: L036788) is a high-purity organic compound featuring a bromophenyl group attached to a propanenitrile backbone. This versatile molecule serves as a valuable intermediate in pharmaceutical and agrochemical synthesis, particularly in the development of bioactive compounds such as enzyme inhibitors and receptor modulators. Its well-defined structure and reactivity make it suitable for diverse chemical transformations, including cross-coupling reactions and other functional group modifications. 2-(4-Bromophenyl)propanenitrile is an essential building block for research in medicinal chemistry, fine chemical production, and advanced material science applications.
CAS Number | 42186-06-1 |
Molecular Formula | C9H8BrN |
Purity | ≥95% |
IUPAC Name | 2-(4-bromophenyl)propanenitrile |
InChI | InChI=1S/C9H8BrN/c1-7(6-11)8-2-4-9(10)5-3-8/h2-5,7H,1H3 |
InChIKey | FSSOXPFLDSMDKO-UHFFFAOYSA-N |
SMILES | CC(C#N)C1=CC=C(C=C1)Br |