For research use only. Not for therapeutic Use.
2-(4-Chloro-3-sulfobenzoyl)-benzoic acid (Cat No.:C000766) is a chemical compound composed of a benzoic acid core with a sulfobenzoyl group and a chlorine atom attached. This compound likely holds significance in organic synthesis and potential applications in various fields. Its unique structure suggests reactivity and potential interactions in chemical reactions. Researchers may study its properties, reactivity, and potential uses in creating novel compounds or materials.
CAS Number | 345930-32-7 |
Molecular Formula | C₁₄H₉ClO₆S |
Purity | ≥95% |
Solubility | DMSO (Slightly), Methanol (Slightly) |
Appearance | White to Off-White Solid |
Storage | 4°C, Inert atmosphere |
IUPAC Name | 2-(4-chloro-3-sulfobenzoyl)benzoic acid |
InChI | InChI=1S/C14H9ClO6S/c15-11-6-5-8(7-12(11)22(19,20)21)13(16)9-3-1-2-4-10(9)14(17)18/h1-7H,(H,17,18)(H,19,20,21) |
InChIKey | RJYDOLIJCOTRRK-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C(=O)C2=CC(=C(C=C2)Cl)S(=O)(=O)O)C(=O)O |
Reference | Beisenherz, et al.: Arch. Int. Pharmacodyn. Ther., 161, 76 (1966); Zsoter, et al.: J. Pharmacol. Exp. Ther., 180, 723 (1972); Singer, J.M., et al.: Anal. Profiles Drug Subs., 14, 1 (1985) |