For research use only. Not for therapeutic Use.
2-(4-Chlorophenyl)-2-methylpropanoic acid(Cat No.:L046995)is an important intermediate used in pharmaceutical and organic chemistry. Its structure, featuring a chlorinated phenyl ring and a methyl-substituted propanoic acid group, provides versatility for synthesizing bioactive compounds. This compound is commonly employed in the development of pharmaceuticals, agrochemicals, and specialty chemicals. Its reactivity allows for further functionalization, making it valuable in drug discovery for creating novel therapeutic agents. The presence of both a carboxylic acid and chlorophenyl group facilitates its use in various chemical reactions, including esterification and amidation.
CAS Number | 6258-30-6 |
Molecular Formula | C10H11ClO2 |
Purity | ≥95% |
IUPAC Name | 2-(4-chlorophenyl)-2-methylpropanoic acid |
InChI | InChI=1S/C10H11ClO2/c1-10(2,9(12)13)7-3-5-8(11)6-4-7/h3-6H,1-2H3,(H,12,13) |
InChIKey | SSFDAZXGUKDEAH-UHFFFAOYSA-N |
SMILES | CC(C)(C1=CC=C(C=C1)Cl)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |