For research use only. Not for therapeutic Use.
2-(4-Chlorophenyl)-3-oxopropanenitrile is an aromatic compound featuring a 4-chlorophenyl group attached to a β-ketonitrile structure, widely used as an intermediate in pharmaceutical and agrochemical synthesis. Its structure, with both a ketone and nitrile functional group, enhances its reactivity, making it ideal for synthesizing heterocyclic and bioactive compounds. This compound is particularly valuable in developing drugs targeting enzymes and receptors, providing a versatile building block in medicinal chemistry and organic synthesis for complex molecular frameworks.
CAS Number | 62538-21-0 |
Molecular Formula | C9H6ClNO |
Purity | ≥95% |
IUPAC Name | 2-(4-chlorophenyl)-3-oxopropanenitrile |
InChI | InChI=1S/C9H6ClNO/c10-9-3-1-7(2-4-9)8(5-11)6-12/h1-4,6,8H |
InChIKey | DAEXXSXAEMFPHQ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(C=O)C#N)Cl |