For research use only. Not for therapeutic Use.
2-(4-Chlorophenyl)acetamide(Cat No.:L025377)is an organic compound featuring a chlorophenyl group attached to an acetamide moiety. This structure lends the molecule both lipophilic and hydrophilic properties, enhancing its versatility in pharmaceutical synthesis. The chlorophenyl group increases the molecule’s ability to interact with various biological targets, making it a valuable intermediate for developing analgesics, anti-inflammatory agents, and other therapeutic compounds. Acetamide serves as a functional group that can undergo further chemical transformations, facilitating the synthesis of more complex derivatives. 2-(4-Chlorophenyl)acetamide is pivotal in creating new drugs with improved efficacy and pharmacokinetic profiles.
Catalog Number | L025377 |
CAS Number | 20101-92-2 |
Molecular Formula | C8H8ClNO |
Purity | ≥95% |
IUPAC Name | 2-(4-chlorophenyl)acetamide |
InChI | InChI=1S/C8H8ClNO/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H2,10,11) |
InChIKey | BFYGROHYLCZLGS-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CC(=O)N)Cl |