For research use only. Not for therapeutic Use.
2-(4-chlorophenyl)morpholine hydrochloride(Cat No.:L007747), is a chemical compound characterized by a morpholine ring attached to a 4-chlorophenyl group. This compound is frequently utilized in pharmaceutical research and drug development due to its unique structure, which often imparts specific biological activities. Its role in medicinal chemistry involves its incorporation into molecules designed to interact with biological targets, potentially leading to the creation of new therapeutic agents. Researchers explore derivatives of this compound to modulate its properties, aiming to discover novel drugs for various diseases and conditions.
CAS Number | 155138-25-3 |
Molecular Formula | C10H13Cl2NO |
Purity | ≥95% |
IUPAC Name | 2-(4-chlorophenyl)morpholine;hydrochloride |
InChI | InChI=1S/C10H12ClNO.ClH/c11-9-3-1-8(2-4-9)10-7-12-5-6-13-10;/h1-4,10,12H,5-7H2;1H |
InChIKey | VUEDLLVHFJZRCC-UHFFFAOYSA-N |
SMILES | C1COC(CN1)C2=CC=C(C=C2)Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |