For research use only. Not for therapeutic Use.
2-(4-Chlorophenyl)piperazine dihydrochloride(Cat No.:L022586)is a high-purity chemical compound widely utilized in pharmaceutical research and drug development. Featuring a 4-chlorophenyl group attached to a piperazine ring, this compound is essential for synthesizing various bioactive molecules, particularly in the development of central nervous system drugs, including antidepressants and antipsychotics. Its structure makes it a valuable building block in medicinal chemistry, facilitating the creation of targeted therapeutic agents. 2-(4-Chlorophenyl)piperazine dihydrochloride ensures reliability and precision in advanced synthetic applications.
CAS Number | 1185157-51-0 |
Molecular Formula | C10H15Cl3N2 |
Purity | ≥95% |
IUPAC Name | 2-(4-chlorophenyl)piperazine;dihydrochloride |
InChI | InChI=1S/C10H13ClN2.2ClH/c11-9-3-1-8(2-4-9)10-7-12-5-6-13-10;;/h1-4,10,12-13H,5-7H2;2*1H |
InChIKey | FKKKAACZISPRMO-UHFFFAOYSA-N |
SMILES | C1CNC(CN1)C2=CC=C(C=C2)Cl.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |