2-(4-Ethylcyclohexyl)acetic acid

For research use only. Not for therapeutic Use.

  • CAT Number: L007211
  • CAS Number: 74603-22-8
  • Molecular Formula: C10H18O2
  • Molecular Weight: 170.25
  • Purity: ≥95%
Inquiry Now

2-(4-Ethylcyclohexyl)acetic acid(Cat No.:L007211), is a chemical compound with the molecular formula C10H18O2. It consists of a cyclohexyl ring substituted with an ethyl group at the 4th position and an acetic acid functional group at the 2nd position. This compound is significant in organic synthesis and medicinal chemistry research. Its cyclohexyl moiety imparts unique stereochemistry and rigidity, making it valuable for designing molecules targeting specific biological receptors. Researchers explore derivatives of this compound for various pharmacological applications, contributing to drug discovery efforts and the development of potential pharmaceutical agents, furthering advancements in medicinal chemistry and bioorganic chemistry research.


CAS Number 74603-22-8
Molecular Formula C10H18O2
Purity ≥95%
Storage Room Temperature
IUPAC Name 2-(4-ethylcyclohexyl)acetic acid
InChI InChI=1S/C10H18O2/c1-2-8-3-5-9(6-4-8)7-10(11)12/h8-9H,2-7H2,1H3,(H,11,12)
InChIKey GLCIYJYIWHJAEJ-UHFFFAOYSA-N
SMILES CCC1CCC(CC1)CC(=O)O

Request a Quote