For research use only. Not for therapeutic Use.
[2-(4-Ethylpiperazin-1-yl)phenyl]methanol is an organic compound characterized by a phenyl group attached to a methanol moiety and a piperazine ring with an ethyl substituent at the 4-position. This structure imparts unique properties that enhance its potential applications in medicinal chemistry. The piperazine ring is known for its biological activity, while the phenyl and methanol components can influence solubility and reactivity. This compound may serve as a valuable scaffold for developing novel pharmaceuticals and exploring structure-activity relationships in drug discovery.
CAS Number | 914349-49-8 |
Molecular Formula | C13H20N2O |
Purity | ≥95% |
IUPAC Name | [2-(4-ethylpiperazin-1-yl)phenyl]methanol |
InChI | InChI=1S/C13H20N2O/c1-2-14-7-9-15(10-8-14)13-6-4-3-5-12(13)11-16/h3-6,16H,2,7-11H2,1H3 |
InChIKey | KRYOTUHYCVJRAS-UHFFFAOYSA-N |
SMILES | CCN1CCN(CC1)C2=CC=CC=C2CO |