For research use only. Not for therapeutic Use.
2-(4-Fluorophenyl)-1,3,2-dioxaborinane(CAT: L000464) is a significant compound in the field of organic chemistry, particularly in the synthesis of organic molecules. This compound serves as a versatile building block, finding applications in various areas, including pharmaceutical, agrochemical, and material chemistry. Its unique structure and reactivity make it a valuable tool for chemists and researchers, allowing them to create a wide range of organic compounds for different purposes.
CAS Number | 156942-21-1 |
Molecular Formula | C9H10BFO2 |
Purity | ≥95% |
IUPAC Name | 2-(4-fluorophenyl)-1,3,2-dioxaborinane |
InChI | InChI=1S/C9H10BFO2/c11-9-4-2-8(3-5-9)10-12-6-1-7-13-10/h2-5H,1,6-7H2 |
InChIKey | BVFPBWCLIYGSMJ-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |