For research use only. Not for therapeutic Use.
2-(4-Fluorophenyl)-1H-indole(CAT: M180356) is a high-purity aromatic compound widely utilized in pharmaceutical and chemical research. Featuring a 4-fluorophenyl group attached to the indole core, it serves as a versatile building block for synthesizing bioactive molecules, including drug candidates and receptor modulators. Its unique structure facilitates diverse chemical transformations, such as cross-coupling and functionalization reactions, enabling the development of novel derivatives. With consistent performance and reliable reactivity, 2-(4-Fluorophenyl)-1H-indole is a valuable tool for advancing research in medicinal chemistry and innovative organic synthesis applications.
CAS Number | 782-17-2 |
Molecular Formula | C14H10FN |
Purity | ≥95% |
IUPAC Name | 2-(4-fluorophenyl)-1H-indole |
InChI | InChI=1S/C14H10FN/c15-12-7-5-10(6-8-12)14-9-11-3-1-2-4-13(11)16-14/h1-9,16H |
InChIKey | VLHGDCJIDNVRFM-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=C(N2)C3=CC=C(C=C3)F |