For research use only. Not for therapeutic Use.
2-(4-Fluorophenyl)oxirane (Cat.No:M084969) is a chemical compound used as a versatile building block in organic synthesis. Its epoxide ring structure and fluorophenyl group make it valuable for constructing complex molecules in medicinal chemistry and material science. This compound contributes to the creation of diverse compounds with specific properties and functions.
Catalog Number | M084969 |
CAS Number | 18511-62-1 |
Molecular Formula | C8H7FO |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | 2-(4-fluorophenyl)oxirane |
InChI | InChI=1S/C8H7FO/c9-7-3-1-6(2-4-7)8-5-10-8/h1-4,8H,5H2 |
InChIKey | ICVNPQMUUHPPOK-UHFFFAOYSA-N |
SMILES | C1C(O1)C2=CC=C(C=C2)F |