For research use only. Not for therapeutic Use.
2-(4-Fluorophenyl)thiophene (Cat No.:R045657) is an organic compound. It is a thiophene derivative with a fluorine-substituted phenyl group. Thiophenes are five-membered heterocyclic compounds containing a sulfur atom. The addition of a fluorine atom to the phenyl group may impart specific properties, making it potentially useful in various applications.
Catalog Number | R045657 |
CAS Number | 58861-48-6 |
Molecular Formula | C10H7FS |
Purity | ≥95% |
Storage | 2-8°C(protect from light) |
IUPAC Name | 2-(4-fluorophenyl)thiophene |
InChI | InChI=1S/C10H7FS/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h1-7H |
InChIKey | PURJRGMZIKXDMW-UHFFFAOYSA-N |
SMILES | C1=CSC(=C1)C2=CC=C(C=C2)F |