For research use only. Not for therapeutic Use.
2-(4-Isothiocyanatobenzyl)-1,4,7-triazacyclononane-1,4,7-triacetic acid (Cat.No:M097048) is a chemical compound with applications in chelation chemistry. It features a triazacyclononane core with an isothiocyanate functional group, making it valuable for binding and isolating metal ions in analytical and biological research. This compound is often used in radiopharmaceuticals for imaging and targeted therapy.
CAS Number | 147597-66-8 |
Molecular Formula | C20H26N4O6S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[4,7-bis(carboxymethyl)-5-[(4-isothiocyanatophenyl)methyl]-1,4,7-triazonan-1-yl]acetic acid |
InChI | InChI=1S/C20H26N4O6S/c25-18(26)11-22-5-6-23(12-19(27)28)10-17(24(8-7-22)13-20(29)30)9-15-1-3-16(4-2-15)21-14-31/h1-4,17H,5-13H2,(H,25,26)(H,27,28)(H,29,30) |
InChIKey | ABEIJMWLNYUWMD-UHFFFAOYSA-N |
SMILES | C1CN(CC(N(CCN1CC(=O)O)CC(=O)O)CC2=CC=C(C=C2)N=C=S)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |