For research use only. Not for therapeutic Use.
2-((4-Methoxybenzyl)amino)ethanol(CAT: L037943) is a versatile organic compound featuring an ethanol backbone and a 4-methoxybenzyl group attached to an amine. The combination of hydroxyl (-OH) and amine (-NH) functional groups makes it an excellent intermediate in chemical synthesis, particularly in pharmaceutical research and medicinal chemistry. Its methoxy-substituted aromatic ring provides electron-donating properties, influencing reactivity and solubility. This compound is valuable in the creation of amides, esters, and other nitrogen-containing derivatives, making it ideal for developing therapeutic agents or bioactive molecules. Its dual functionality allows for easy incorporation into more complex molecular structures for various synthetic applications.
CAS Number | 64834-63-5 |
Molecular Formula | C10H15NO2 |
Purity | ≥95% |
IUPAC Name | 2-[(4-methoxyphenyl)methylamino]ethanol |
InChI | InChI=1S/C10H15NO2/c1-13-10-4-2-9(3-5-10)8-11-6-7-12/h2-5,11-12H,6-8H2,1H3 |
InChIKey | UBLCRUHXSMDNQZ-UHFFFAOYSA-N |