For research use only. Not for therapeutic Use.
2-(4-(Methoxycarbonyl)phenyl)acetic acid(Cat No.:L037914)is an aromatic carboxylic acid derivative used in pharmaceutical research and organic synthesis. This compound features a methoxycarbonyl group attached to a phenyl ring at the 4-position, with an acetic acid group connected to the phenyl ring. It serves as a versatile intermediate in the synthesis of bioactive molecules, including potential therapeutic agents and agrochemicals. The combination of the ester and carboxylic acid functionalities allows for diverse chemical transformations, making it valuable in medicinal chemistry, drug discovery, and the development of advanced materials.
CAS Number | 22744-12-3 |
Molecular Formula | C10H10O4 |
Purity | ≥95% |
IUPAC Name | 2-(4-methoxycarbonylphenyl)acetic acid |
InChI | InChI=1S/C10H10O4/c1-14-10(13)8-4-2-7(3-5-8)6-9(11)12/h2-5H,6H2,1H3,(H,11,12) |
InChIKey | TXZVCDJZNRCDKW-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC=C(C=C1)CC(=O)O |