For research use only. Not for therapeutic Use.
2-(4-Methoxyphenyl)-1,3,2-dioxaborinane(CAT: L000485) is a compound of importance in the field of organic chemistry. It acts as a versatile building block in the synthesis of various organic molecules, particularly in the development of material chemistry and pharmaceutical intermediates. This compound plays a crucial role in creating functionalized organic materials and pharmaceuticals, enabling the design of innovative materials and drug candidates.
CAS Number | 155826-85-0 |
Molecular Formula | C10H13BO3 |
Purity | ≥95% |
IUPAC Name | 2-(4-methoxyphenyl)-1,3,2-dioxaborinane |
InChI | InChI=1S/C10H13BO3/c1-12-10-5-3-9(4-6-10)11-13-7-2-8-14-11/h3-6H,2,7-8H2,1H3 |
InChIKey | VJYUVWJFKJTXTK-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |