For research use only. Not for therapeutic Use.
2-(4-Methoxyphenyl)ethanol (Cat.No:R012698) is a chemical compound with applications in various industries. It is utilized as a fragrance ingredient in perfumes and cosmetics due to its pleasant odor. Additionally, it serves as an intermediate in organic synthesis, contributing to the production of diverse compounds in pharmaceutical and chemical processes.
Catalog Number | R012698 |
CAS Number | 702-23-8 |
Synonyms | 4-Methoxybenzeneethanol; 1-Methoxy-4-(2-hydroxyethyl)benzene; 2-(4-Methoxyphenyl)-1-ethanol; 2-(p-Anisyl)ethanol; 4-Methoxyphenethyl Alcohol; NSC 408325; p-(Methoxyphenyl)ethyl Alcohol; p-Methoxyphenethyl Alcohol; β-(p-Methoxyphenyl)ethanol; ? |
Molecular Formula | C9H12O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(4-methoxyphenyl)ethanol |
InChI | InChI=1S/C9H12O2/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5,10H,6-7H2,1H3 |
InChIKey | AUWDOZOUJWEPBA-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)CCO |