For research use only. Not for therapeutic Use.
2-(4-Methylthiazol-5-yl)ethyl butyrate(CAT: L036941) is a high-purity thiazole derivative featuring a butyrate ester moiety. This compound is widely utilized in pharmaceutical research and flavor chemistry due to its heterocyclic structure and ester functionality. Its thiazole core, known for bioactive properties, makes it a valuable intermediate for synthesizing drug candidates, fine chemicals, and agricultural products. The butyrate group enhances its reactivity and versatility in chemical transformations, enabling its use in the development of complex organic frameworks. 2-(4-Methylthiazol-5-yl)ethyl butyrate ensures excellent stability and precision, making it a critical building block for advanced research in medicinal chemistry and material science.
CAS Number | 94159-31-6 |
Molecular Formula | C10H15NO2S |
Purity | ≥95% |
IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl butanoate |
InChI | InChI=1S/C10H15NO2S/c1-3-4-10(12)13-6-5-9-8(2)11-7-14-9/h7H,3-6H2,1-2H3 |
InChIKey | GDRZNYCKSKHESZ-UHFFFAOYSA-N |
SMILES | CCCC(=O)OCCC1=C(N=CS1)C |