For research use only. Not for therapeutic Use.
2-(4-Nitro-1-oxoisoindolin-2-yl) pentanoic Acid (Cat No.:C000727) is a chemical compound characterized by a pentanoic acid backbone with a 4-nitro-1-oxoisoindolin-2-yl substituent. This structure suggests its involvement in organic synthesis or medicinal chemistry, possibly as a building block for creating more complex molecules. Its isoindoline moiety may hold significance in the design of bioactive compounds due to its structural resemblance to certain pharmacophores. Research on 2-(4-Nitro-1-oxoisoindolin-2-yl) pentanoic Acid may aim to explore its reactivity, potential interactions, or contributions to the development of novel molecules with desired properties for various applications.
| Catalog Number | C000727 |
| CAS Number | 295357-72-1 |
| Synonyms | 2-(1,3-Dihydro-4-nitro-1-oxo-2H-isoindol-2-yl)pentanedioic Acid; |
| Molecular Formula | C₁₃H₁₂N₂O₇ |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | 2-(7-nitro-3-oxo-1H-isoindol-2-yl)pentanedioic acid |
| InChI | InChI=1S/C13H12N2O7/c16-11(17)5-4-10(13(19)20)14-6-8-7(12(14)18)2-1-3-9(8)15(21)22/h1-3,10H,4-6H2,(H,16,17)(H,19,20) |
| InChIKey | RZPMMKDWVZJPMQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2[N+](=O)[O-])C(=O)N1C(CCC(=O)O)C(=O)O |
| Reference | Bartlett, J.B., et al.: Nature Rev., 4, 314 (2004), Mitsiades, C.S., et al.: Curr. Opin. Invest. Drugs, 5, 635 (2004), List, A., et al.: N. Engl. J. Med., 352, 549 (2005), |
