For research use only. Not for therapeutic Use.
2-(4-Piperidinyloxy)pyridine(CAT: M140908) is a high-purity heterocyclic compound widely used in pharmaceutical, chemical, and biochemical research. Featuring a pyridine core attached to a piperidinyloxy group, this compound serves as a versatile intermediate in the synthesis of bioactive molecules, particularly in the development of pharmacological agents that target neurotransmitter systems. Its structure is particularly valuable for studying receptor interactions, enzyme inhibition, and as a building block in medicinal chemistry. With excellent stability and reactivity, 2-(4-Piperidinyloxy)pyridine ensures precision and reliability, making it an essential tool for advanced research and innovative synthetic applications.
CAS Number | 127806-46-6 |
Molecular Formula | C10H14N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-piperidin-4-yloxypyridine |
InChI | InChI=1S/C10H14N2O/c1-2-6-12-10(3-1)13-9-4-7-11-8-5-9/h1-3,6,9,11H,4-5,7-8H2 |
InChIKey | XORIOVHPKOZEMR-UHFFFAOYSA-N |
SMILES | C1CNCCC1OC2=CC=CC=N2 |