For research use only. Not for therapeutic Use.
(2-((4-(Trifluoromethoxy)phenoxy)methyl)phenyl)boronic acid(Cat No.:L023758)is a boronic acid derivative used as a key intermediate in organic synthesis, particularly in the development of pharmaceuticals and advanced materials. The presence of the boronic acid group allows for cross-coupling reactions, such as Suzuki-Miyaura coupling, enabling the formation of carbon-carbon bonds. The trifluoromethoxy and phenoxy groups enhance the molecule’s reactivity and potential biological activity, making it a valuable building block in medicinal chemistry. This compound is instrumental in synthesizing complex aromatic structures and designing novel therapeutic agents with improved pharmacokinetic properties.
CAS Number | 849062-07-3 |
Molecular Formula | C14H12BF3O4 |
Purity | ≥95% |
IUPAC Name | [2-[[4-(trifluoromethoxy)phenoxy]methyl]phenyl]boronic acid |
InChI | InChI=1S/C14H12BF3O4/c16-14(17,18)22-12-7-5-11(6-8-12)21-9-10-3-1-2-4-13(10)15(19)20/h1-8,19-20H,9H2 |
InChIKey | VVFYLZIEJWOSIP-UHFFFAOYSA-N |
SMILES | B(C1=CC=CC=C1COC2=CC=C(C=C2)OC(F)(F)F)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |