Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors>
>
2-(4,4-Difluoropiperidin-1-yl)ethanamine dihydrochloride
For research use only. Not for therapeutic Use.
2-(4,4-Difluoropiperidin-1-yl)ethanamine dihydrochloride(CAT: L000368) is a chemical compound with potential applications in various scientific domains. Its structure includes a piperidine ring, an ethanamine group, and difluorine substituents, suggesting diverse interactions. This compound may engage with specific biological targets, making it intriguing for medicinal chemistry and drug development. Its mode of action could involve modulation of cellular processes, potentially influencing disease-related pathways. The dihydrochloride form enhances its solubility and stability.
Catalog Number | L000368 |
CAS Number | 1609345-55-2 |
Molecular Formula | C7H16Cl2F2N2 |
Purity | ≥95% |
IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)ethanamine;dihydrochloride |
InChI | InChI=1S/C7H14F2N2.2ClH/c8-7(9)1-4-11(5-2-7)6-3-10;;/h1-6,10H2;2*1H |
InChIKey | QIZZEVXZXRVHRZ-UHFFFAOYSA-N |