Home
>
Chemical Reagents>Aldehydes> 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzaldehyde
For research use only. Not for therapeutic Use.
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzaldehyde (Cat.No:L003562) is a crucial chemical compound in medicinal chemistry. Its unique structure incorporates a boron-containing motif and a trifluoromethyl group, making it a versatile building block for the synthesis of pharmaceutical agents. This compound’s distinctive features render it valuable in drug development, highlighting its significance in the quest for novel therapeutic compounds.
Catalog Number | L003562 |
CAS Number | 1219936-17-0 |
Molecular Formula | C14H16BF3O3 |
Purity | ≥95% |
IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzaldehyde |
InChI | InChI=1S/C14H16BF3O3/c1-12(2)13(3,4)21-15(20-12)11-6-5-10(14(16,17)18)7-9(11)8-19/h5-8H,1-4H3 |
InChIKey | AGPQHPPDNCNRJQ-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(F)(F)F)C=O |