For research use only. Not for therapeutic Use.
2-(4,5-Dihydro-2-oxazolyl)quinoline(Cat No.:L019831)is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. This molecule features a quinoline core linked to a dihydro-oxazole ring, making it a versatile intermediate in the synthesis of bioactive compounds, including potential drug candidates and agrochemicals. Its unique structure allows for selective reactivity in various chemical transformations, facilitating the exploration of new therapeutic agents. 2-(4,5-Dihydro-2-oxazolyl)quinoline is essential for precise synthetic applications, contributing to advancements in medicinal chemistry and innovative research.
Catalog Number | L019831 |
CAS Number | 202191-12-6 |
Molecular Formula | C12H10N2O |
Purity | ≥95% |
IUPAC Name | 2-quinolin-2-yl-4,5-dihydro-1,3-oxazole |
InChI | InChI=1S/C12H10N2O/c1-2-4-10-9(3-1)5-6-11(14-10)12-13-7-8-15-12/h1-6H,7-8H2 |
InChIKey | USDSJWOYSHFPND-UHFFFAOYSA-N |
SMILES | C1COC(=N1)C2=NC3=CC=CC=C3C=C2 |