Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
2-[(4R)-4,5-Dihydro-4-isopropyl-2-oxazolyl]pyridine
For research use only. Not for therapeutic Use.
2-[(4R)-4,5-Dihydro-4-isopropyl-2-oxazolyl]pyridine is a heterocyclic compound featuring a pyridine ring and a substituted oxazole moiety. The oxazole is characterized by a 4-isopropyl group and a dihydro configuration at the 4R position, which enhances its structural complexity and potential reactivity. This compound is of interest in medicinal chemistry due to its potential biological activity and ability to participate in various organic reactions. It may serve as a valuable intermediate in the synthesis of pharmaceuticals and other bioactive compounds.
Catalog Number | L002568 |
CAS Number | 132187-16-7 |
Molecular Formula | C11H14N2O |
Purity | ≥95% |
IUPAC Name | (4R)-4-propan-2-yl-2-pyridin-2-yl-4,5-dihydro-1,3-oxazole |
InChI | InChI=1S/C11H14N2O/c1-8(2)10-7-14-11(13-10)9-5-3-4-6-12-9/h3-6,8,10H,7H2,1-2H3/t10-/m0/s1 |
InChIKey | OAQJLSASJWIYMU-JTQLQIEISA-N |
SMILES | CC(C)[C@@H]1COC(=N1)C2=CC=CC=N2 |