For research use only. Not for therapeutic Use.
2-(5-Bromo-1H-indol-1-yl)ethanol(Cat No.:L036189)is a brominated indole derivative, notable for its inclusion of an ethanol side chain. This structural feature enhances its solubility and reactivity, making it a versatile intermediate in pharmaceutical and biochemical research. It is particularly valuable in the synthesis of serotonin receptor agonists and antagonists, leveraging its indole core, which mimics the natural indole structure of tryptophan-derived neurotransmitters. Additionally, its bromine atom provides a reactive site for further chemical modifications, crucial for the development of new therapeutic agents targeting neurological and psychological disorders.
CAS Number | 148366-28-3 |
Molecular Formula | C10H10BrNO |
Purity | ≥95% |
IUPAC Name | 2-(5-bromoindol-1-yl)ethanol |
InChI | InChI=1S/C10H10BrNO/c11-9-1-2-10-8(7-9)3-4-12(10)5-6-13/h1-4,7,13H,5-6H2 |
InChIKey | VQBGZOPEJRCONC-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CN2CCO)C=C1Br |