For research use only. Not for therapeutic Use.
2-(6-Bromopyridin-2-yl)ethanol is a brominated pyridine derivative with a hydroxyl-ethyl group attached at the 2-position of the pyridine ring and a bromine atom at the 6-position. This compound is commonly used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its structure allows for further functionalization through reactions at either the bromine or hydroxyl group, making it useful in cross-coupling reactions such as Suzuki-Miyaura or nucleophilic substitution. Researchers employ 2-(6-Bromopyridin-2-yl)ethanol in the creation of bioactive molecules and in medicinal chemistry for drug development and discovery.
Catalog Number | R052148 |
CAS Number | 955370-07-7 |
Synonyms | 6-Bromo-2-pyridineethanol; |
Molecular Formula | C7H8BrNO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(6-bromopyridin-2-yl)ethanol |
InChI | InChI=1S/C7H8BrNO/c8-7-3-1-2-6(9-7)4-5-10/h1-3,10H,4-5H2 |
InChIKey | BUSVXLMCEYFMCS-UHFFFAOYSA-N |
SMILES | C1=CC(=NC(=C1)Br)CCO |