For research use only. Not for therapeutic Use.
2-(6-Chloro-5-methylpyridin-3-yl)acetic acid (Cat.No:L004143) is a significant chemical compound with diverse applications. Its unique structure, featuring a chloromethylpyridine and acetic acid moiety, imparts specialized reactivity. This compound serves as a crucial intermediate in the synthesis of specialized molecules with potential pharmaceutical activity.
CAS Number | 1000546-06-4 |
Molecular Formula | C8H8ClNO2 |
Purity | ≥95% |
IUPAC Name | 2-(6-chloro-5-methylpyridin-3-yl)acetic acid |
InChI | InChI=1S/C8H8ClNO2/c1-5-2-6(3-7(11)12)4-10-8(5)9/h2,4H,3H2,1H3,(H,11,12) |
InChIKey | BLMQSKNWZLCAEW-UHFFFAOYSA-N |
SMILES | CC1=CC(=CN=C1Cl)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |