Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-((7-Nitro-1H-benzo[d]imidazol-2-yl)thio)acetic acid
For research use only. Not for therapeutic Use.
2-((7-Nitro-1H-benzo[d]imidazol-2-yl)thio)acetic acid(CAT: L000296) is a compound with importance in pharmaceutical and organic chemistry. This chemical serves as a valuable intermediate in the synthesis of pharmaceutical compounds. Its action method involves acting as a key building block in the development of drug candidates, particularly in the context of drug discovery and development. In the realm of organic chemistry, it plays a role in the synthesis of various organic compounds.
CAS Number | 92824-09-4 |
Molecular Formula | C9H7N3O4S |
Purity | ≥95% |
IUPAC Name | 2-[(4-nitro-1H-benzimidazol-2-yl)sulfanyl]acetic acid |
InChI | InChI=1S/C9H7N3O4S/c13-7(14)4-17-9-10-5-2-1-3-6(12(15)16)8(5)11-9/h1-3H,4H2,(H,10,11)(H,13,14) |
InChIKey | QTOYMAXZJZKRRY-UHFFFAOYSA-N |