For research use only. Not for therapeutic Use.
2-Acetyl-3-Methylquinoxalinediium-1,4-Diolate（Cat No.:M055311）is a synthetic compound primarily studied for its potential biochemical and pharmaceutical applications, particularly in research focused on nitrogen oxide (NO) donation. It belongs to a class of compounds known as quinoxaline derivatives, which are recognized for their diverse biological activities. This compound can release nitric oxide under specific conditions, potentially aiding in studies related to vasodilation, inflammation, and oxidative stress. As a NO donor, it may be used in experimental setups examining cell signaling pathways, cardiovascular effects, and other physiological processes influenced by nitric oxide.
| Catalog Number | M055311 |
| CAS Number | 13297-17-1 |
| Molecular Formula | C11H10N2O3 |
| Purity | ≥95% |
| Target | Cell Cycle/DNA Damage |
| Storage | Store at -20C |
| IUPAC Name | 1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)ethanone |
| InChI | InChI=1S/C11H10N2O3/c1-7-11(8(2)14)13(16)10-6-4-3-5-9(10)12(7)15/h3-6H,1-2H3 |
| InChIKey | CUJMCPPBTUATEJ-UHFFFAOYSA-N |
| SMILES | CC1=C([N+](=O)C2=CC=CC=C2N1[O-])C(=O)C |
