For research use only. Not for therapeutic Use.
2-Acetylpyrimidine is a heterocyclic compound featuring a pyrimidine ring with an acetyl group at the 2-position. This compound is significant in organic synthesis and medicinal chemistry due to its versatile reactivity and potential biological activities. 2-Acetylpyrimidine can serve as a building block for the synthesis of various pharmaceuticals, agrochemicals, and biologically active compounds. Its unique structure allows for diverse functionalizations, making it valuable in developing new therapeutic agents and exploring applications in drug discovery and materials science.
| Catalog Number | L046604 |
| CAS Number | 53342-27-1 |
| Molecular Formula | C6H6N2O |
| Purity | ≥95% |
| IUPAC Name | 1-pyrimidin-2-ylethanone |
| InChI | InChI=1S/C6H6N2O/c1-5(9)6-7-3-2-4-8-6/h2-4H,1H3 |
| InChIKey | SPZUXKZZYDALEY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC=CC=N1 |
