2-Acetylthiazole-13C2（Cat No.:R071701） is an isotopically labeled version of 2-acetylthiazole, enriched with two carbon-13 atoms, enhancing its utility in flavor research and food science. This compound is critical for studying the formation and breakdown of flavor compounds in foods and beverages. Its stable isotope labeling allows for precise tracking and quantification in complex matrices, improving the accuracy of analytical assessments. 2-Acetylthiazole-13C2 is invaluable in sensory analysis, product development, and quality control processes, ensuring detailed insight into flavor profiles and their impact on consumer preferences.
| Catalog Number | R071701 |
| Synonyms | 4-Ethyloctanoic acid 1,2-13C2 |
| Molecular Formula | C5H5NOS |
| Purity | 95% |
| Solubility | Pure substance |
| IUPAC Name | 1-(1,3-thiazol-2-yl)(1,2-13C2)ethanone |
| InChI | InChI=1S/C5H5NOS/c1-4(7)5-6-2-3-8-5/h2-3H,1H3/i1+1,4+1 |
| InChIKey | MOMFXATYAINJML-VFZPYAPFSA-N |
| SMILES | [13CH3][13C](=O)C1=NC=CS1 |
