For research use only. Not for therapeutic Use.
2-Acrylamide-2-methylpropanesulfonic acid (Cat No.:M077412) is a chemical compound. It features an acrylamide group linked to a 2-methylpropanesulfonic acid moiety. This compound is significant in polymer chemistry and materials science due to its use in the synthesis of superabsorbent polymers. Its sulfonic acid functionality adds water solubility and ion exchange properties. These polymers are utilized in various applications including water-absorbing materials, drug-delivery systems, and coatings. The compound’s role in polymerization reactions contributes to its importance in creating materials with unique properties and applications in diverse industries, ranging from hygiene products to pharmaceuticals.
CAS Number | 15214-89-8 |
Molecular Formula | C7H13NO4S |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid |
InChI | InChI=1S/C7H13NO4S/c1-4-6(9)8-7(2,3)5-13(10,11)12/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12) |
InChIKey | XHZPRMZZQOIPDS-UHFFFAOYSA-N |
SMILES | CC(C)(CS(=O)(=O)O)NC(=O)C=C |