For research use only. Not for therapeutic Use.
Deoxyguanosine (CAT: I013892) is a purine nucleoside consisting of the nitrogenous base guanine attached to the sugar deoxyribose via a β-N9-glycosidic bond. It is a fundamental building block of DNA, where it pairs with cytosine through hydrogen bonding. Deoxyguanosine plays a critical role in DNA synthesis, repair, and replication processes. In research, it is widely utilized for studying nucleic acid metabolism, the effects of oxidative stress on DNA, and the mechanisms of mutagenesis. Its structural simplicity and biological significance make it a valuable tool in molecular biology, biochemistry, and pharmaceutical research.
| Catalog Number | I013892 |
| CAS Number | 961-07-9 |
| Molecular Formula | C₁₀H₁₃N₅O₄ |
| Purity | ≥95% |
| Target | Others |
| Solubility | DMSO: ≥ 31 mg/mL |
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one |
| InChI | InChI=1S/C10H13N5O4/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6/h3-6,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5+,6+/m0/s1 |
| InChIKey | YKBGVTZYEHREMT-KVQBGUIXSA-N |
| SMILES | C1C(C(OC1N2C=NC3=C2NC(=NC3=O)N)CO)O |
