Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 2-Amino-1-(piperidin-1-yl)ethanone hydrochloride
For research use only. Not for therapeutic Use.
2-Amino-1-(piperidin-1-yl) methanone hydrochloride(Cat No.:L017298), is a chemical compound used in organic synthesis and pharmaceutical research. It is a piperidinyl ketone with an amino group attached to the alpha position of the ketone. The hydrochloride form is a common salt used for stability. This compound serves as an intermediate in synthesizing various organic molecules and pharmaceutical agents. Its unique structure makes it valuable in drug development and medicinal chemistry research.
CAS Number | 5437-48-9 |
Molecular Formula | C7H15ClN2O |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 2-amino-1-piperidin-1-ylethanone;hydrochloride |
InChI | InChI=1S/C7H14N2O.ClH/c8-6-7(10)9-4-2-1-3-5-9;/h1-6,8H2;1H |
InChIKey | OINZXLOVUKWACU-UHFFFAOYSA-N |
SMILES | C1CCN(CC1)C(=O)CN.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |