Home
>
Materials Science>Organic ligands for MOF materials> 2-Amino-[1,1'-biphenyl]-4,4'-dicarboxylic acid
For research use only. Not for therapeutic Use.
2-Amino-[1,1′-biphenyl]-4,4′-dicarboxylic acid (Cat.No:L003518) is a significant chemical compound in pharmaceutical research. Its distinctive structure and properties make it a crucial building block for the development of novel pharmaceuticals, particularly in the field of biphenyl-based pharmacophores.
CAS Number | 1240557-01-0 |
Molecular Formula | C14H11NO4 |
Purity | ≥95% |
IUPAC Name | 3-amino-4-(4-carboxyphenyl)benzoic acid |
InChI | InChI=1S/C14H11NO4/c15-12-7-10(14(18)19)5-6-11(12)8-1-3-9(4-2-8)13(16)17/h1-7H,15H2,(H,16,17)(H,18,19) |
InChIKey | FYEKGZUXGKAJJQ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)C(=O)O)N)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |