For research use only. Not for therapeutic Use.
2-Amino-1H-benzo[d]imidazole-5-carbonitrile(Cat No.:L017302)is a versatile heterocyclic compound widely used in pharmaceutical and chemical research. This molecule, featuring an amino group and a carbonitrile group on a benzimidazole scaffold, is essential for synthesizing various bioactive compounds, including antiviral, anticancer, and antimicrobial agents. Its unique structure enables it to act as a building block in the creation of complex molecular frameworks. With high purity and consistency, 2-Amino-1H-benzo[d]imidazole-5-carbonitrile is a valuable intermediate in drug discovery and development processes.
CAS Number | 63655-40-3 |
Molecular Formula | C8H6N4 |
Purity | ≥95% |
IUPAC Name | 2-amino-3H-benzimidazole-5-carbonitrile |
InChI | InChI=1S/C8H6N4/c9-4-5-1-2-6-7(3-5)12-8(10)11-6/h1-3H,(H3,10,11,12) |
InChIKey | PNMKRBOIMTZVLQ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1C#N)NC(=N2)N |