For research use only. Not for therapeutic Use.
2-Amino-2-(2,6-difluorophenyl)acetic acid hydrochloride (Cat.No:L004079) is a significant chemical compound with applications in pharmaceutical research. Its unique structure, incorporating a difluorophenyl and aminoacetic acid motif, imparts specialized properties. This compound serves as a valuable intermediate in the synthesis of bioactive molecules, particularly in the field of medicinal chemistry.
CAS Number | 2411635-69-1 |
Molecular Formula | C8H8ClF2NO2 |
Purity | ≥95% |
IUPAC Name | 2-amino-2-(2,6-difluorophenyl)acetic acid;hydrochloride |
InChI | InChI=1S/C8H7F2NO2.ClH/c9-4-2-1-3-5(10)6(4)7(11)8(12)13;/h1-3,7H,11H2,(H,12,13);1H |
InChIKey | BPPHUYSXALJONZ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)F)C(C(=O)O)N)F.Cl |