For research use only. Not for therapeutic Use.
2-Amino-2-(3,4-dimethoxyphenyl)acetic acid(CAT: L047290) is a phenylglycine derivative featuring an amino group and two methoxy groups attached to a phenyl ring at the 3- and 4-positions. This compound is of interest in medicinal chemistry due to its structural similarity to amino acids, which makes it a valuable intermediate for the synthesis of pharmaceuticals and bioactive compounds. The dimethoxyphenyl moiety can impart increased lipophilicity and metabolic stability, while the amino acid backbone offers flexibility for modifications in peptide synthesis or drug design. It may be used in the development of receptor modulators, and enzyme inhibitors, or as a precursor in the synthesis of complex therapeutic agents.
CAS Number | 91819-11-3 |
Molecular Formula | C10H13NO4 |
Purity | ≥95% |
IUPAC Name | 2-amino-2-(3,4-dimethoxyphenyl)acetic acid |
InChI | InChI=1S/C10H13NO4/c1-14-7-4-3-6(5-8(7)15-2)9(11)10(12)13/h3-5,9H,11H2,1-2H3,(H,12,13) |
InChIKey | HVFSBZGHEZRVGA-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |