For research use only. Not for therapeutic Use.
2-Amino-3-bromo-5-(trifluoromethyl)benzoic acid (Cat.No:L003499) is a crucial compound in medicinal chemistry. Its unique structure, incorporating a trifluoromethyl group, imparts valuable pharmacological properties. This compound serves as a key intermediate in the synthesis of pharmaceutical agents, highlighting its significance in drug development.
CAS Number | 1434631-44-3 |
Molecular Formula | C8H5BrF3NO2 |
Purity | ≥95% |
IUPAC Name | 2-amino-3-bromo-5-(trifluoromethyl)benzoic acid |
InChI | InChI=1S/C8H5BrF3NO2/c9-5-2-3(8(10,11)12)1-4(6(5)13)7(14)15/h1-2H,13H2,(H,14,15) |
InChIKey | JEYCNCNKTWYLBJ-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1C(=O)O)N)Br)C(F)(F)F |