For research use only. Not for therapeutic Use.
2-Amino-3-bromo-5-(trifluoromethyl)benzonitrile (Cat.No:L003500) is a key chemical compound with diverse applications in pharmaceutical and agrochemical research. Its distinctive structure and trifluoromethyl substitution pattern contribute to its significance as a valuable building block in drug discovery and synthesis of biologically active compounds.
CAS Number | 133013-30-6 |
Molecular Formula | C8H4BrF3N2 |
Purity | ≥95% |
IUPAC Name | 2-amino-3-bromo-5-(trifluoromethyl)benzonitrile |
InChI | InChI=1S/C8H4BrF3N2/c9-6-2-5(8(10,11)12)1-4(3-13)7(6)14/h1-2H,14H2 |
InChIKey | OYUGWGDNFYZWSZ-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1C#N)N)Br)C(F)(F)F |