For research use only. Not for therapeutic Use.
2-Amino-3-carboxy-1,4-naphthoquinone is the electron transfer mediator. 2-Amino-3-carboxy-1,4-naphthoquinone changes glucose metabolism of the homofermentative lactic acid bacteria[1].
Catalog Number | I044833 |
CAS Number | 173043-38-4 |
Synonyms | 1-hydroxy-3-imino-4-oxonaphthalene-2-carboxylic acid |
Molecular Formula | C11H7NO4 |
Purity | ≥95% |
InChI | InChI=1S/C11H7NO4/c12-8-7(11(15)16)9(13)5-3-1-2-4-6(5)10(8)14/h1-4,12-13H,(H,15,16) |
InChIKey | LUUNBSJOKUEDSL-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=C(C(=N)C2=O)C(=O)O)O |
Reference | [1]. Yamazaki S, et al. Glucose metabolism of lactic acid bacteria changed by quinone-mediated extracellular electron transfer. Biosci Biotechnol Biochem. 2002;66(10):2100-2106. |