For research use only. Not for therapeutic Use.
2-Amino-3-chloro-N-hydroxy-propanamide is a versatile compound used in organic and medicinal chemistry. Its structure contains an amino group, a chloro-substituted carbon, and a hydroxamic acid moiety, making it an important intermediate in the synthesis of biologically active molecules, particularly enzyme inhibitors. The presence of both the amine and hydroxyl functional groups allows it to participate in key reactions like nucleophilic substitution and condensation, enhancing its utility in drug development. This compound is often employed in research targeting metalloproteinases and other enzymes, contributing to the study of potential therapeutic agents for cancer and inflammatory diseases.
CAS Number | 120854-55-9 |
Synonyms | 2-Amino-3-chloro-propionohydroxamic |
Molecular Formula | C3H7ClN2O2 |
Purity | ≥95% |
Storage | 4°C |
IUPAC Name | 2-amino-3-chloro-N-hydroxypropanamide |
InChI | InChI=1S/C3H7ClN2O2/c4-1-2(5)3(7)6-8/h2,8H,1,5H2,(H,6,7) |
InChIKey | QCWBXJPECQJXKJ-UHFFFAOYSA-N |
SMILES | C(C(C(=O)NO)N)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |