For research use only. Not for therapeutic Use.
2-Amino-3-chlorobenzamide(CAT: M126115) is a high-purity aromatic compound featuring an amino group, a chlorine atom, and a benzamide functional group. This versatile molecule is widely used as an intermediate in pharmaceutical research, organic synthesis, and the development of bioactive compounds. Its structure allows for targeted modifications, making it valuable in medicinal chemistry for synthesizing small-molecule inhibitors, heterocycles, and therapeutic candidates. Known for its stability and reactivity, 2-Amino-3-chlorobenzamide supports precision synthesis, enabling the creation of advanced intermediates and fine chemicals for both academic and industrial research applications.
CAS Number | 18343-44-7 |
Synonyms | 2-AMINO-3-CHLOROBENZAMIDE |
Molecular Formula | C7H7ClN2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-amino-3-chlorobenzamide |
InChI | InChI=1S/C7H7ClN2O/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,9H2,(H2,10,11) |
InChIKey | BINWIYVHWRWUSD-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)Cl)N)C(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |