For research use only. Not for therapeutic Use.
2-Amino-3-hydroxyanthraquinone(Cat No.:M068656) is a chemical compound derived from anthraquinone, characterized by its molecular structure containing an amino group and a hydroxyl group attached to adjacent carbon atoms on the anthraquinone backbone. This compound is utilized in the production of dyes, particularly vat dyes, which are widely employed in textile dyeing processes. Its vibrant color and lightfastness properties make it desirable for dyeing cotton, wool, and silk fibers. Additionally, 2-amino-3-hydroxyanthraquinone finds applications in the pharmaceutical industry as a precursor in the synthesis of certain drugs and research laboratories as a reagent in organic chemistry reactions.
CAS Number | 117-77-1 |
Molecular Formula | C14H9NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-amino-3-hydroxyanthracene-9,10-dione |
InChI | InChI=1S/C14H9NO3/c15-11-5-9-10(6-12(11)16)14(18)8-4-2-1-3-7(8)13(9)17/h1-6,16H,15H2 |
InChIKey | CNWWMJSRHGXXAX-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C=C3C2=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |